CAS 89204-91-1

Methyl 5-(2-chlorophenyl)-4-oxazolecarboxylate

Description:

Methyl 5-(2-chlorophenyl)-4-oxazolecarboxylate is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of the 2-chlorophenyl group indicates that there is a chlorine atom substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate functional group. It may be used in various applications, including pharmaceuticals and agrochemicals, owing to its potential biological activity. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks. Overall, Methyl 5-(2-chlorophenyl)-4-oxazolecarboxylate is a compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₁H₈ClNO₃

InChI: InChI=1S/C11H8ClNO3/c1-15-11(14)9-10(16-6-13-9)7-4-2-3-5-8(7)12/h2-6H,1H3

InChI key: InChIKey=OPVGROBAFGODPL-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC=N1)C2=C(Cl)C=CC=C2

Synonyms:

• 4-Oxazolecarboxylic acid, 5-(2-chlorophenyl)-, methyl ester
• Methyl 5-(2-chlorophenyl)-1,3-oxazole-4-carboxylate
• Methyl 5-(2-chlorophenyl)-4-oxazolecarboxylate
• Methyl 5-(2-chlorophenyl)oxazole-4-carboxylate

Methyl 5-(2-chlorophenyl)oxazole-4-carboxylate

CAS: 89204-91-1

Formula: C₁₁H₈ClNO₃

Molecular weight: 237.6391

Ref: IN-DA00446I

Methyl 5-(2-chlorophenyl)-1,3-oxazole-4-carboxylate

CAS: 89204-91-1

Methyl 5-(2-chlorophenyl)-1,3-oxazole-4-carboxylate

Purity: ≥95%

Molecular weight: 237.64g/mol

Ref: 54-OR59389