CAS 89204-93-3
:Methyl 5-(4-chlorophenyl)-4-oxazolecarboxylate
Description:
Methyl 5-(4-chlorophenyl)-4-oxazolecarboxylate, identified by its CAS number 89204-93-3, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 4-chlorophenyl group enhances its biological activity and may influence its interactions in various chemical environments. Typically, compounds like this may exhibit properties such as moderate to high stability under standard conditions, and they may participate in various chemical reactions, including nucleophilic substitutions and esterifications. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and biological activity. Safety data should be consulted for handling and usage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C11H8ClNO3
InChI:InChI=1S/C11H8ClNO3/c1-15-11(14)9-10(16-6-13-9)7-2-4-8(12)5-3-7/h2-6H,1H3
InChI key:InChIKey=MGGPQBAELYVXMR-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC=N1)C2=CC=C(Cl)C=C2
Synonyms:- Methyl 5-(4-chlorophenyl)-4-oxazolecarboxylate
- 4-Oxazolecarboxylic acid, 5-(4-chlorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
