CAS 89205-09-4
:5-(3,4,5-Trimethoxyphenyl)-4-oxazolecarboxylic acid
Description:
5-(3,4,5-Trimethoxyphenyl)-4-oxazolecarboxylic acid, with the CAS number 89205-09-4, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing nitrogen and oxygen. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 3,4,5-trimethoxyphenyl group indicates that it has three methoxy (-OCH3) substituents on a phenyl ring, which can enhance its solubility and influence its biological activity. The compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple methoxy groups can affect the compound's electronic properties, potentially impacting its interactions with biological targets. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C13H13NO6
InChI:InChI=1S/C13H13NO6/c1-17-8-4-7(5-9(18-2)12(8)19-3)11-10(13(15)16)14-6-20-11/h4-6H,1-3H3,(H,15,16)
InChI key:InChIKey=VQZBAKIKTIULBP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C2=CC(OC)=C(OC)C(OC)=C2)OC=N1
Synonyms:- 4-Oxazolecarboxylic acid, 5-(3,4,5-trimethoxyphenyl)-
- 5-(3,4,5-Trimethoxyphenyl)-4-oxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
