CAS 89208-22-0
:Hexanedioic acid, 3-(1-methylethyl)-, bis(6-hydroxyhexyl) ester
Description:
Hexanedioic acid, 3-(1-methylethyl)-, bis(6-hydroxyhexyl) ester, also known by its CAS number 89208-22-0, is an organic compound characterized by its ester functional groups derived from hexanedioic acid and a branched alkyl chain. This compound typically exhibits a moderate molecular weight and is likely to be a viscous liquid or solid at room temperature, depending on its specific structure and the presence of functional groups. It is soluble in organic solvents and may have limited solubility in water due to its hydrophobic alkyl chains. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can influence its physical properties such as boiling point and viscosity. Hexanedioic acid derivatives are often used in the synthesis of polymers, plasticizers, and surfactants, making this compound potentially useful in various industrial applications. Additionally, its structure may impart specific characteristics such as thermal stability and compatibility with other materials, which are important for its performance in practical applications.
Formula:C21H40O6
InChI:InChI=1S/C21H40O6/c1-18(2)19(17-21(25)27-16-10-6-4-8-14-23)11-12-20(24)26-15-9-5-3-7-13-22/h18-19,22-23H,3-17H2,1-2H3
InChI key:PQRAUOXFPLGKEC-UHFFFAOYSA-N
SMILES:CC(C)C(CCC(=O)OCCCCCCO)CC(=O)OCCCCCCO
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Hexanedioic acid, 3-(1-methylethyl)-, bis(6-hydroxyhexyl) ester
CAS:Formula:C21H40O6Molecular weight:388.5387
