CAS 89211-37-0
:Methyl 3-(methylsulfonyl)propanoate
Description:
Methyl 3-(methylsulfonyl)propanoate, with the CAS number 89211-37-0, is an organic compound characterized by its ester functional group and the presence of a methylsulfonyl moiety. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic alkyl chains. The presence of the methylsulfonyl group imparts unique chemical properties, including potential reactivity in nucleophilic substitution reactions. Methyl 3-(methylsulfonyl)propanoate is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its stability under standard conditions makes it a useful intermediate in chemical reactions. Additionally, it may exhibit biological activity, although specific biological properties would depend on the context of its use. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C5H10O4S
InChI:InChI=1S/C5H10O4S/c1-9-5(6)3-4-10(2,7)8/h3-4H2,1-2H3
InChI key:InChIKey=GQHBXCVAMSARRD-UHFFFAOYSA-N
SMILES:C(C(OC)=O)CS(C)(=O)=O
Synonyms:- Propanoic acid, 3-(methylsulfonyl)-, methyl ester
- Methyl 3-(methylsulfonyl)propanoate
- 3-Methanesulfonyl-propionic acid methyl ester
- Propionic acid, 3-(methylsulfonyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
