CAS 892127-08-1
:1-(2-aminothiophen-3-yl)ethanone
Description:
1-(2-Aminothiophen-3-yl)ethanone, with the CAS number 892127-08-1, is an organic compound characterized by the presence of a thiophene ring substituted with an amino group and an ethanone moiety. The structure features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties. The amino group (-NH2) attached to the thiophene enhances its reactivity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications in pharmaceuticals. The ethanone functional group introduces a carbonyl (C=O) functionality, which is known for its role in nucleophilic addition reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, and it may participate in various synthetic pathways, including coupling reactions and functionalization. Overall, 1-(2-aminothiophen-3-yl)ethanone is a versatile compound with potential applications in organic synthesis and drug development.
Formula:C6H7NOS
InChI:InChI=1/C6H7NOS/c1-4(8)5-2-3-9-6(5)7/h2-3H,7H2,1H3
SMILES:CC(=O)c1ccsc1N
Synonyms:- 1-(2-Amino-3-thienyl)ethanone
- Ethanone, 1-(2-Amino-3-Thienyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-(2-amino-3-thienyl)- (9CI)
CAS:Formula:C6H7NOSPurity:96%Color and Shape:SolidMolecular weight:141.19091-(2-Aminothiophen-3-yl)ethanone
CAS:1-(2-Aminothiophen-3-yl)ethanonePurity:99%Molecular weight:141.19g/mol1-(2-Aminothiophen-3-yl)ethanone
CAS:<p>1-(2-Aminothiophen-3-yl)ethanone is a reagent that is used in cross-coupling reactions. It is also an efficient method for the synthesis of 1,2,3-triazoles from pyridines and thiophenes and it has been shown to be a potent inhibitor of bacterial infection. This compound inhibits the production of proinflammatory cytokines such as TNF-α. 1-(2-Aminothiophen-3-yl)ethanone has been found to have antidepressant effects, which may be due to its ability to inhibit the uptake of serotonin by neurons.</p>Formula:C6H7NOSPurity:Min. 95%Molecular weight:141.19 g/mol



