CymitQuimica logo

CAS 892154-51-7

:

{4-[(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxy]phenyl}methanol

Description:
The chemical substance known as {4-[(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)oxy]phenyl}methanol, with the CAS number 892154-51-7, is characterized by its unique structure that includes a phenolic group and a long perfluorinated alkyl chain. This compound exhibits hydrophobic properties due to the presence of the nonafluoroheptyl group, which contributes to its low surface energy and potential applications in surface modification and coatings. The hydroxyl (-OH) group in the phenylmethanol portion provides the compound with potential for hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the fluorinated segment imparts chemical stability and resistance to degradation, making it suitable for use in harsh environments. Its unique combination of hydrophobic and hydrophilic characteristics may also allow for interesting interactions in biological systems or materials science applications. Overall, this compound's distinctive properties make it a subject of interest in various fields, including materials chemistry and surface science.
Formula:C14H13F9O2
InChI:InChI=1/C14H13F9O2/c15-11(16,12(17,18)13(19,20)14(21,22)23)6-1-7-25-10-4-2-9(8-24)3-5-10/h2-5,24H,1,6-8H2
SMILES:C(CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)COc1ccc(cc1)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.