CAS 892154-66-4

[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phenyl]methanol

Description:

[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phenyl]methanol, with the CAS number 892154-66-4, is a fluorinated organic compound characterized by its unique structure that includes a phenyl group substituted with a nonafluorohexyl chain and a hydroxymethyl group. This compound exhibits hydrophobic properties due to the presence of the nonafluoroalkyl chain, which imparts significant surface activity and potential applications in surface modification and as a surfactant. The fluorinated segment enhances thermal and chemical stability, making it suitable for various industrial applications, including coatings and materials science. Additionally, the hydroxymethyl group contributes to its reactivity, allowing for further chemical modifications. The presence of fluorine atoms typically results in low surface energy, which can lead to water and oil repellency. Overall, this compound's unique combination of hydrophobicity, stability, and reactivity makes it a subject of interest in both research and industrial applications.

Formula: C₁₃H₁₁F₉O

InChI: InChI=1/C13H11F9O/c14-10(15,11(16,17)12(18,19)13(20,21)22)6-5-8-1-3-9(7-23)4-2-8/h1-4,23H,5-7H2

SMILES: c1cc(ccc1CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)CO

4-(3,3,4,4,5,5,6,6,6-Nonafluorohexyl)benzyl alcohol

CAS: 892154-66-4

Formula: C₁₃H₁₁F₉O

Molecular weight: 354.2115

Ref: IN-DA003K0K