CymitQuimica logo

CAS 89216-54-6

:

cyclopentane, (1-methylhexyl)-

Description:
Cyclopentane, (1-methylhexyl)-, with the CAS number 89216-54-6, is an organic compound characterized by its cyclopentane ring structure substituted with a 1-methylhexyl group. This compound is part of the class of alicyclic hydrocarbons, which are cyclic compounds that contain carbon atoms arranged in a ring. The presence of the 1-methylhexyl group introduces a branched alkyl chain, contributing to its unique physical and chemical properties. Typically, cyclopentane derivatives exhibit moderate volatility and are generally non-polar, making them less soluble in water but soluble in organic solvents. The compound may possess a relatively low boiling point compared to larger hydrocarbons, and its structure can influence its reactivity, stability, and interactions with other substances. Cyclopentane derivatives are often studied for their applications in various fields, including organic synthesis and materials science, due to their interesting chemical behavior and potential utility in creating more complex molecules. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C12H24
InChI:InChI=1/C12H24/c1-3-4-5-8-11(2)12-9-6-7-10-12/h11-12H,3-10H2,1-2H3
Synonyms:
  • Heptan-2-ylcyclopentane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.