CAS 89218-54-2
:2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl N,N-dimethylglycinate hydrochloride (1:1)
Description:
2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl N,N-dimethylglycinate hydrochloride is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity. This substance features a nitro group and a methyl substituent on the imidazole, enhancing its pharmacological properties. The presence of the N,N-dimethylglycinate moiety suggests potential interactions with biological systems, particularly in terms of its role as a neurotransmitter or in metabolic pathways. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound's molecular structure indicates it may exhibit specific biological activities, potentially as an antimicrobial or antifungal agent, although detailed studies would be necessary to confirm these effects. Its CAS number, 89218-54-2, allows for precise identification in chemical databases, aiding researchers in locating relevant literature and safety data. Overall, this compound's unique structural features position it as a subject of interest in medicinal chemistry and drug development.
Formula:C10H17ClN4O4
InChI:InChI=1/C10H16N4O4.ClH/c1-8-11-6-9(14(16)17)13(8)4-5-18-10(15)7-12(2)3;/h6H,4-5,7H2,1-3H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-methyl-5-nitro-imidazol-1-yl)ethyl 2-dimethylaminoacetate hydrochloride
CAS:Formula:C10H17ClN4O4Molecular weight:292.7194
