CAS 89218-91-7
:N-(1H-Benzimidazol-2-ylmethyl)-N-(carboxymethyl)glycine
Description:
N-(1H-Benzimidazol-2-ylmethyl)-N-(carboxymethyl)glycine, commonly referred to as a derivative of glycine, exhibits several notable characteristics. This compound features a benzimidazole moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the carboxymethyl group enhances its solubility in aqueous environments, making it suitable for various applications, including pharmaceuticals and biochemistry. The structure suggests that it may act as a chelating agent, potentially interacting with metal ions due to the nitrogen and carboxylate functionalities. Additionally, the compound's ability to form hydrogen bonds can influence its reactivity and interactions with biological targets. Its unique combination of functional groups may also impart specific properties such as pH sensitivity and stability under physiological conditions. Overall, this compound's characteristics make it a subject of interest for further research in drug development and biochemical applications.
Formula:C12H13N3O4
InChI:InChI=1S/C12H13N3O4/c16-11(17)6-15(7-12(18)19)5-10-13-8-3-1-2-4-9(8)14-10/h1-4H,5-7H2,(H,13,14)(H,16,17)(H,18,19)
InChI key:InChIKey=INEZAVVPHRUSIC-UHFFFAOYSA-N
SMILES:C(N(CC(O)=O)CC(O)=O)C=1NC=2C(N1)=CC=CC2
Synonyms:- Glycine, N-(1H-benzimidazol-2-ylmethyl)-N-(carboxymethyl)-
- 2-[1H-Benzimidazol-2-ylmethyl(carboxymethyl)amino]acetic acid
- N-(1H-Benzimidazol-2-ylmethyl)-N-(carboxymethyl)glycine
- N-(Benzimidazol-2-ylmethyl)iminodiacetic acid
- Acetic acid, (2-benzimidazolylmethylimino)di-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycine, N-(1H-benzimidazol-2-ylmethyl)-N-(carboxymethyl)-
CAS:Formula:C12H13N3O4Molecular weight:263.2493
