CAS 892240-97-0
:2-(2-butyl-1H-benzimidazol-1-yl)propanoic acid
Description:
2-(2-butyl-1H-benzimidazol-1-yl)propanoic acid, identified by its CAS number 892240-97-0, is a chemical compound that features a benzimidazole moiety substituted with a butyl group and a propanoic acid functional group. This compound typically exhibits characteristics common to benzimidazole derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory properties. The presence of the propanoic acid group suggests it may participate in acid-base reactions, and its structure may influence its solubility and reactivity in various solvents. The butyl substituent can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and interaction with biological membranes. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and pharmaceutical applications, although specific biological activities and properties would require empirical investigation to fully characterize its behavior in biological systems.
Formula:C14H18N2O2
InChI:InChI=1/C14H18N2O2/c1-3-4-9-13-15-11-7-5-6-8-12(11)16(13)10(2)14(17)18/h5-8,10H,3-4,9H2,1-2H3,(H,17,18)
SMILES:CCCCc1nc2ccccc2n1C(C)C(=O)O
Synonyms:- 1H-benzimidazole-1-acetic acid, 2-butyl-α-methyl-
- 2-(2-Butyl-1H-benzimidazol-1-yl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
