CymitQuimica logo

CAS 892241-05-3

:

2-[2-(2-methylpropyl)-1H-benzimidazol-1-yl]propanoic acid

Description:
2-[2-(2-methylpropyl)-1H-benzimidazol-1-yl]propanoic acid, identified by its CAS number 892241-05-3, is a chemical compound characterized by its unique structure that includes a benzimidazole moiety and a propanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility, stability, and reactivity. The presence of the benzimidazole ring suggests potential biological activity, as many benzimidazole derivatives are known for their pharmacological properties. The branched alkyl group (2-methylpropyl) may enhance lipophilicity, affecting the compound's interaction with biological membranes and its overall bioavailability. Additionally, the carboxylic acid group contributes to its acidity and potential for forming salts or esters. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of exploring its therapeutic applications and mechanisms of action.
Formula:C14H18N2O2
InChI:InChI=1/C14H18N2O2/c1-9(2)8-13-15-11-6-4-5-7-12(11)16(13)10(3)14(17)18/h4-7,9-10H,8H2,1-3H3,(H,17,18)
SMILES:CC(C)Cc1nc2ccccc2n1C(C)C(=O)O
Synonyms:
  • 1H-benzimidazole-1-acetic acid, alpha-methyl-2-(2-methylpropyl)-
  • 2-(2-Isobutyl-1H-benzimidazol-1-yl)propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.