CymitQuimica logo

CAS 89226-80-2

:

6-(1-Ethylpropyl)-2-pyridinamine

Description:
6-(1-Ethylpropyl)-2-pyridinamine, with the CAS number 89226-80-2, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethylpropyl substituent at the 6-position of the pyridine ring and an amino group (-NH2) at the 2-position, contributing to its basicity and potential reactivity. The presence of the amino group allows for hydrogen bonding, which can influence its solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the functional groups present. Overall, 6-(1-Ethylpropyl)-2-pyridinamine is a compound of interest for further study in both synthetic and applied chemistry contexts.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c1-3-8(4-2)9-6-5-7-10(11)12-9/h5-8H,3-4H2,1-2H3,(H2,11,12)
InChI key:InChIKey=KOTYIRKFSTXHGC-UHFFFAOYSA-N
SMILES:C(CC)(CC)C=1N=C(N)C=CC1
Synonyms:
  • 2-Pyridinamine, 6-(1-ethylpropyl)-
  • 6-(1-Ethylpropyl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.