CAS 89227-65-6
:5-[(dimethylamino)methylidene]pyrimidine-2,4,6(1H,3H,5H)-trione
Description:
5-[(Dimethylamino)methylidene]pyrimidine-2,4,6(1H,3H,5H)-trione, commonly referred to as a pyrimidine derivative, is a chemical compound characterized by its unique structure that includes a pyrimidine ring substituted with a dimethylamino group and a methylene bridge. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the dimethylamino group suggests basicity, which may influence its reactivity and interactions with other chemical species. The trione functional groups contribute to its potential as a diketone, which can participate in various chemical reactions, including condensation and nucleophilic attacks. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 89227-65-6, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H9N3O3
InChI:InChI=1/C7H9N3O3/c1-10(2)3-4-5(11)8-7(13)9-6(4)12/h3H,1-2H3,(H2,8,9,11,12,13)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-[(Dimethylamino)methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione
CAS:Formula:C7H9N3O3Molecular weight:183.1647
