
CAS 89228-68-2
:2-Methyl-6-benzofurancarboxaldehyde
Description:
2-Methyl-6-benzofurancarboxaldehyde is an organic compound characterized by its unique structure, which features a benzofuran moiety with a methyl group and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic syntheses. Additionally, 2-Methyl-6-benzofurancarboxaldehyde may exhibit biological activity, making it of interest in medicinal chemistry and natural product synthesis. Its chemical properties include a relatively low boiling point and a moderate density, which are typical for compounds of this class. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, this compound is significant in both synthetic organic chemistry and potential applications in pharmaceuticals or fragrance industries.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c1-7-4-9-3-2-8(6-11)5-10(9)12-7/h2-6H,1H3
InChI key:InChIKey=HDFGYIQAKGZZKY-UHFFFAOYSA-N
SMILES:CC1=CC=2C(=CC(C=O)=CC2)O1
Synonyms:- 2-Methyl-6-benzofurancarboxaldehyde
- 2-Methyl-1-benzofuran-6-carbaldehyde
- 2-Methylbenzofuran-6-carbaldehyde
- 6-Benzofurancarboxaldehyde, 2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.