CymitQuimica logo

CAS 89229-92-5

:

Ethyl 2-cyano-3-phenylbicyclo[2.2.2]oct-5-ene-2-carboxylate

Description:
Ethyl 2-cyano-3-phenylbicyclo[2.2.2]oct-5-ene-2-carboxylate, with the CAS number 89229-92-5, is a bicyclic compound characterized by its unique bicyclo[2.2.2]octane framework, which contributes to its rigidity and potential for interesting chemical reactivity. This compound features a cyano group and an ethyl ester functional group, which can influence its solubility and reactivity in various chemical environments. The presence of the phenyl group adds to its aromatic character, potentially enhancing its stability and interaction with other aromatic systems. Ethyl 2-cyano-3-phenylbicyclo[2.2.2]oct-5-ene-2-carboxylate may exhibit interesting properties such as fluorescence or specific reactivity in organic synthesis, making it a candidate for applications in materials science or pharmaceuticals. Its structural features suggest potential for undergoing various chemical transformations, including nucleophilic substitutions or cycloadditions, which are common in compounds with similar functionalities. Overall, this compound represents a fascinating example of bicyclic chemistry with potential utility in diverse chemical applications.
Formula:C18H19NO2
InChI:InChI=1S/C18H19NO2/c1-2-21-17(20)18(12-19)15-10-8-14(9-11-15)16(18)13-6-4-3-5-7-13/h3-8,10,14-16H,2,9,11H2,1H3
InChI key:InChIKey=MFNCOJHITLZVAV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(C#N)C(C2C=CC1CC2)C3=CC=CC=C3
Synonyms:
  • Bicyclo[2.2.2]oct-5-ene-2-carboxylic acid, 2-cyano-3-phenyl-, ethyl ester
  • Ethyl 2-cyano-3-phenylbicyclo[2.2.2]oct-5-ene-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.