CAS 89238-99-3
:4-methoxybenzyl 2,2,2-trichloroethanimidoate
Description:
4-Methoxybenzyl 2,2,2-trichloroethanimidoate, with the CAS number 89238-99-3, is an organic compound characterized by its functional groups and structural features. It contains a methoxy group (-OCH3) attached to a benzyl moiety, which contributes to its aromatic properties. The presence of the trichloroethanimidoate group indicates that it has a high degree of chlorination, which can influence its reactivity and stability. This compound is likely to exhibit moderate to low solubility in water due to its hydrophobic aromatic structure, but it may be soluble in organic solvents. The trichloro substituents can impart significant electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methoxy group can participate in resonance, affecting the electronic distribution within the molecule. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed due to the presence of chlorinated compounds.
Formula:C10H10Cl3NO2
InChI:InChI=1/C10H10Cl3NO2/c1-15-8-4-2-7(3-5-8)6-16-9(14)10(11,12)13/h2-5,14H,6H2,1H3
SMILES:COc1ccc(cc1)COC(=N)C(Cl)(Cl)Cl
Synonyms:- Ethanimidic Acid, 2,2,2-Trichloro-, (4-Methoxyphenyl)Methyl Ester
- 2,2,2-TrichloroacetiMidic Acid 4-Methoxybenzyl Ester
- 4-Methoxybenzyl 2,2,2-Trichloroethanimidate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxybenzyl 2,2,2-Trichloroacetimidate
CAS:Formula:C10H10Cl3NO2Purity:>96.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:282.554-Methoxybenzyl 2,2,2-Trichloroacetimidate
CAS:Formula:C10H10Cl3NO2Purity:98%Color and Shape:LiquidMolecular weight:282.55094-Methoxybenzyl 2,2,2-trichloroacetimidate
CAS:<p>4-Methoxybenzyl 2,2,2-trichloroacetimidate</p>Formula:C10H10Cl3NO2Purity:98%Color and Shape: clear. orange liquidMolecular weight:282.55g/mol4-Methoxybenzyl 2,2,2-trichloroacetimidate
CAS:Formula:C10H10Cl3NO2Purity:98%Color and Shape:No data available.Molecular weight:282.55



