CAS 89239-23-6
:1,3,5-Trimethyl-7-(2-methyl-1-aziridinyl)-1H-pyrazolo[4,3-d]pyrimidine
Description:
1,3,5-Trimethyl-7-(2-methyl-1-aziridinyl)-1H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core and an aziridine substituent. This compound features three methyl groups at the 1, 3, and 5 positions of the pyrazolo ring, contributing to its lipophilicity and potential biological activity. The presence of the aziridine ring, a three-membered nitrogen-containing heterocycle, may impart unique reactivity and properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its CAS number, 89239-23-6, allows for easy identification in chemical databases. Overall, this compound exemplifies the diversity of nitrogen-containing heterocycles and their relevance in drug discovery and development.
Formula:C11H15N5
InChI:InChI=1S/C11H15N5/c1-6-5-16(6)11-10-9(12-8(3)13-11)7(2)14-15(10)4/h6H,5H2,1-4H3
InChI key:InChIKey=XNHLWMBQIPEDQR-UHFFFAOYSA-N
SMILES:CN1C2=C(N=C(C)N=C2C(C)=N1)N3C(C)C3
Synonyms:- 1,3,5-Trimethyl-7-(2-methylaziridin-1-yl)pyrazolo[4,3-d]pyrimidine
- 1,3,5-Trimethyl-7-(2-methyl-1-aziridinyl)-1H-pyrazolo[4,3-d]pyrimidine
- 1H-Pyrazolo[4,3-d]pyrimidine, 1,3,5-trimethyl-7-(2-methyl-1-aziridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazolo[4,3-d]pyrimidine, 1,3,5-trimethyl-7-(2-methyl-1-aziridinyl)-
CAS:Formula:C11H15N5Molecular weight:217.2703
