CAS 89239-35-0
:8-ethyl-1,3,5-trimethyl-7,8-dihydro-1H-imidazo[1,2-c]pyrazolo[3,4-e]pyrimidine
Description:
8-Ethyl-1,3,5-trimethyl-7,8-dihydro-1H-imidazo[1,2-c]pyrazolo[3,4-e]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both imidazole and pyrazole rings fused to a pyrimidine moiety. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential bioactivity due to its unique structural features. The presence of multiple methyl groups and an ethyl substituent contributes to its lipophilicity, which may influence its interaction with biological targets. As a member of the imidazo-pyrazolo-pyrimidine class, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential for various applications, including as a scaffold for drug development. However, specific reactivity, stability, and biological activity would depend on the precise conditions and environment in which the compound is studied. Further research would be necessary to fully elucidate its characteristics and potential uses in various fields, including pharmaceuticals and materials science.
Formula:C12H17N5
InChI:InChI=1/C12H17N5/c1-5-9-6-17-8(3)13-10-7(2)15-16(4)11(10)12(17)14-9/h9H,5-6H2,1-4H3
SMILES:CCC1Cn2c(C)nc3c(C)nn(C)c3c2=N1
Synonyms:- 1H-imidazo[1,2-c]pyrazolo[3,4-e]pyrimidine, 8-ethyl-7,8-dihydro-1,3,5-trimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
CI-943
CAS:<p>CI-943 is a pyrimidine compound that has been shown to have atypical antipsychotic activity in Sprague-Dawley rats. CI-943 inhibits dopamine release from the tegmental area of the brain and enhances dopaminergic transmission in the prefrontal cortex. This drug has also been shown to have no toxic effects on sperm production or fertility, as well as being nontoxic to platelets. CI-943 is not active against schizophrenic patients with chronic treatment, but does show some promise for treating chronic schizophrenia in animals.</p>Formula:C12H17N5Purity:Min. 95%Molecular weight:231.3 g/molCI-943
CAS:CI-943 is a novel potential antipsychotic drug that does not bind to dopamine (DA) receptors and has some developmental neurotoxicity.Formula:C12H17N5Purity:98%Color and Shape:SolidMolecular weight:231.3

