CAS 89239-61-2

7-(1-Aziridinyl)-1-ethyl-3,5-dimethyl-1H-pyrazolo[4,3-d]pyrimidine

Description:

7-(1-Aziridinyl)-1-ethyl-3,5-dimethyl-1H-pyrazolo[4,3-d]pyrimidine, with the CAS number 89239-61-2, is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates an aziridine moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure features a fused pyrazole and pyrimidine ring system, which contributes to its potential pharmacological properties. The presence of the aziridine ring may enhance its reactivity and ability to interact with biological targets. Additionally, the ethyl and dimethyl substituents can influence its lipophilicity and solubility, affecting its bioavailability. The compound's synthesis and characterization involve standard organic chemistry techniques, and it may be evaluated for its efficacy in various biological assays. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, particularly in areas such as cancer research or antimicrobial activity, although specific studies would be necessary to elucidate its full potential.

Formula: C₁₁H₁₅N₅

InChI: InChI=1S/C11H15N5/c1-4-16-10-9(7(2)14-16)12-8(3)13-11(10)15-5-6-15/h4-6H2,1-3H3

InChI key: InChIKey=ZXWYDMNSDIDMQI-UHFFFAOYSA-N

SMILES: C(C)N1C2=C(N=C(C)N=C2C(C)=N1)N3CC3

Synonyms:

• 1H-Pyrazolo[4,3-d]pyrimidine, 7-(1-aziridinyl)-1-ethyl-3,5-dimethyl-
• 7-(1-Aziridinyl)-1-ethyl-3,5-dimethyl-1H-pyrazolo[4,3-d]pyrimidine

1H-Pyrazolo[4,3-d]pyrimidine, 7-(1-aziridinyl)-1-ethyl-3,5-dimethyl-

CAS: 89239-61-2

Formula: C₁₁H₁₅N₅

Molecular weight: 217.2703

Ref: IN-DA00432U