CymitQuimica logo

CAS 89241-34-9

:

3-(Hydroxymethyl)-1-(phenylsulfonyl)-1H-indole-2-carboxaldehyde

Description:
3-(Hydroxymethyl)-1-(phenylsulfonyl)-1H-indole-2-carboxaldehyde, with the CAS number 89241-34-9, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a hydroxymethyl group and a phenylsulfonyl moiety, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The sulfonyl group enhances the compound's solubility and may influence its biological activity. This compound is of interest in research due to its potential as a building block in the synthesis of pharmaceuticals or as a probe in biological studies. Its unique structural features may also impart specific interactions with biological targets, making it a candidate for further investigation in drug development. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C16H13NO4S
InChI:InChI=1S/C16H13NO4S/c18-10-14-13-8-4-5-9-15(13)17(16(14)11-19)22(20,21)12-6-2-1-3-7-12/h1-9,11,18H,10H2
InChI key:InChIKey=QTANNNCTXPYUCD-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(CO)=C1C=O)=CC=CC2)C3=CC=CC=C3
Synonyms:
  • 3-(Hydroxymethyl)-1-(phenylsulfonyl)-1H-indole-2-carboxaldehyde
  • 1H-Indole-2-carboxaldehyde, 3-(hydroxymethyl)-1-(phenylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.