CAS 892414-50-5

6-Chloro-4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:

6-Chloro-4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both chlorine and nitro functional groups, as well as a trifluoromethyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The chlorine and nitro substituents can also affect the compound's reactivity and stability, potentially allowing for various chemical transformations. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its CAS number, 892414-50-5, serves as a unique identifier for regulatory and safety information. As with many heterocycles, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of study in both synthetic and medicinal chemistry contexts.

Formula: C₈H₃ClF₃N₃O₂

InChI: InChI=1S/C8H3ClF3N3O2/c9-5-1-4(15(16)17)6-3(8(10,11)12)2-13-7(6)14-5/h1-2H,(H,13,14)

InChI key: InChIKey=OZXNYYPMIUUHTH-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=2C(NC1)=NC(Cl)=CC2N(=O)=O

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 6-chloro-4-nitro-3-(trifluoromethyl)-
• 6-Chloro-4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

1H-PYRROLO[2,3-B]PYRIDINE, 6-CHLORO-4-NITRO-3-(TRIFLUOROMETHYL)-

CAS: 892414-50-5

Formula: C₈H₃ClF₃N₃O₂

Purity: 95.0%

Molecular weight: 265.58

Ref: 10-F502353