CAS 892414-55-0
:4-[[6-Chloro-3-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluorobenzenamine
Description:
The chemical substance known as 4-[[6-Chloro-3-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluorobenzenamine, with the CAS number 892414-55-0, is a complex organic compound characterized by its multi-functional groups and heterocyclic structure. It features a pyrrolopyridine core, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of chlorine and trifluoromethyl groups enhances its lipophilicity and may influence its pharmacokinetic properties. The trimethylsilyl group provides stability and can enhance solubility in organic solvents. Additionally, the difluorobenzene moiety may impart unique electronic properties, making it a candidate for various applications, including pharmaceuticals and agrochemicals. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its reactivity can be influenced by the functional groups present. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry.
Formula:C20H21ClF5N3O2Si
InChI:InChI=1S/C20H21ClF5N3O2Si/c1-32(2,3)5-4-30-10-29-9-12(20(24,25)26)17-15(8-16(21)28-19(17)29)31-18-13(22)6-11(27)7-14(18)23/h6-9H,4-5,10,27H2,1-3H3
InChI key:InChIKey=PVARKZUMVVMKHJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=2C(N(COCC[Si](C)(C)C)C1)=NC(Cl)=CC2OC3=C(F)C=C(N)C=C3F
Synonyms:- 4-[[6-Chloro-3-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluorobenzenamine
- Benzenamine, 4-[[6-chloro-3-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.