
CAS 89242-55-7
:N,N-Diethyl-4-phenyl-2-quinazolinecarboxamide
Description:
N,N-Diethyl-4-phenyl-2-quinazolinecarboxamide, with the CAS number 89242-55-7, is a synthetic organic compound characterized by its quinazoline structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many quinazoline derivatives. It may possess biological activity, often being investigated for its potential pharmacological effects, including anti-cancer and anti-inflammatory properties. The presence of the diethyl and phenyl groups contributes to its lipophilicity, potentially influencing its interaction with biological targets. Additionally, the compound's structure allows for various functional modifications, which can be explored for enhancing its efficacy or selectivity in therapeutic applications. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.
Formula:C19H19N3O
InChI:InChI=1S/C19H19N3O/c1-3-22(4-2)19(23)18-20-16-13-9-8-12-15(16)17(21-18)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3
InChI key:InChIKey=IJBAHHOMQMZVRL-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C=1N=C(C2=C(N1)C=CC=C2)C3=CC=CC=C3
Synonyms:- 2-Quinazolinecarboxamide, N,N-diethyl-4-phenyl-
- N,N-Diethyl-4-phenyl-2-quinazolinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
