CAS 89244-14-4
:N-(Cyanomethyl)-4-methoxy-N-methylbenzamide
Description:
N-(Cyanomethyl)-4-methoxy-N-methylbenzamide, with the CAS number 89244-14-4, is an organic compound characterized by its amide functional group, which is linked to a benzene ring. The presence of a methoxy group (-OCH3) at the para position of the benzene ring contributes to its chemical properties, including potential electron-donating effects that can influence reactivity. The cyanomethyl group (-CH2-CN) introduces a nitrile functionality, which can enhance the compound's polarity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and it may participate in various chemical reactions typical of amides, such as hydrolysis or substitution. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(Cyanomethyl)-4-methoxy-N-methylbenzamide is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-13(8-7-12)11(14)9-3-5-10(15-2)6-4-9/h3-6H,8H2,1-2H3
InChI key:InChIKey=VTFREYKAQOVZDG-UHFFFAOYSA-N
SMILES:C(N(CC#N)C)(=O)C1=CC=C(OC)C=C1
Synonyms:- Benzamide, N-(cyanomethyl)-4-methoxy-N-methyl-
- N-(Cyanomethyl)-4-methoxy-N-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
