
CAS 89244-48-4
:Pyridine, 2,4,5-trimethyl-3-nitro-
Description:
Pyridine, 2,4,5-trimethyl-3-nitro- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features three methyl groups attached to the 2, 4, and 5 positions of the pyridine ring, contributing to its hydrophobic nature and influencing its reactivity. Additionally, a nitro group (-NO2) is present at the 3-position, which is known for its electron-withdrawing properties, affecting the compound's overall electronic characteristics and reactivity. The presence of both the nitro and methyl groups can enhance the compound's potential as a building block in organic synthesis and pharmaceuticals. Typically, compounds like this exhibit moderate to high stability under standard conditions but may undergo electrophilic substitution reactions due to the electron-deficient nature of the nitro group. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require careful handling and storage. Overall, 2,4,5-trimethyl-3-nitropyridine is of interest in various chemical applications, including agrochemicals and dyes.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-5-4-9-7(3)8(6(5)2)10(11)12/h4H,1-3H3
InChI key:InChIKey=YAPQOTYDOUZILG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C)=C(C)C=NC1C
Synonyms:- 2,4,5-Trimethyl-3-nitropyridine
- Pyridine, 2,4,5-trimethyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
