CymitQuimica logo

CAS 89246-31-1

:

2,4(1H,3H)-Pyrimidinedione, 3-methyl-6-(1-methyl-1H-indol-3-yl)-

Description:
2,4(1H,3H)-Pyrimidinedione, 3-methyl-6-(1-methyl-1H-indol-3-yl)-, with CAS number 89246-31-1, is a chemical compound characterized by its pyrimidinedione core structure, which is a bicyclic compound featuring a pyrimidine ring fused with a diketone functionality. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the indole moiety contributes to its potential pharmacological properties, as indoles are known for their diverse biological roles. The methyl groups attached to the pyrimidine and indole rings can influence the compound's solubility, stability, and reactivity. In terms of physical properties, such compounds often display moderate to high melting points and may be soluble in organic solvents. The compound's reactivity can be attributed to the functional groups present, allowing for potential interactions in various chemical environments. Overall, this compound represents a unique structure that may be explored for its therapeutic applications and chemical reactivity.
Formula:C14H13N3O2
InChI:InChI=1S/C14H13N3O2/c1-16-8-10(9-5-3-4-6-12(9)16)11-7-13(18)17(2)14(19)15-11/h3-8H,1-2H3,(H,15,19)
InChI key:InChIKey=LAOGMCCSYURDMT-UHFFFAOYSA-N
SMILES:CN1C=C(C=2C1=CC=CC2)C3=CC(=O)N(C)C(=O)N3
Synonyms:
  • 2,4(1H,3H)-Pyrimidinedione, 3-methyl-6-(1-methyl-1H-indol-3-yl)-
  • 3-Methyl-6-(1-methyl-1H-indol-3-yl)pyrimidine-2,4(1H,3H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.