CAS 89247-06-3

1,6-Dihydro-4-hydroxy-5-nitro-6-oxo-3-pyridinecarboxamide

Description:

1,6-Dihydro-4-hydroxy-5-nitro-6-oxo-3-pyridinecarboxamide, with the CAS number 89247-06-3, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring with various functional groups, including a hydroxyl group, a nitro group, and a carboxamide group, which contribute to its chemical reactivity and potential biological activity. The presence of the nitro group suggests that it may exhibit specific properties such as electron-withdrawing characteristics, which can influence its reactivity in various chemical reactions. The compound's structure indicates that it may participate in hydrogen bonding due to the hydroxyl and amide functionalities, potentially affecting its solubility and interaction with biological targets. While specific applications or biological activities may vary, compounds of this nature are often investigated for their potential use in pharmaceuticals or as intermediates in organic synthesis. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₆H₅N₃O₅

InChI: InChI=1S/C6H5N3O5/c7-5(11)2-1-8-6(12)3(4(2)10)9(13)14/h1H,(H2,7,11)(H2,8,10,12)

InChI key: InChIKey=TUIUMGHPROMFOD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(O)C(C(N)=O)=CNC1=O

Synonyms:

• 1,6-Dihydro-4-hydroxy-5-nitro-6-oxo-3-pyridinecarboxamide
• 3-Pyridinecarboxamide, 1,6-dihydro-4-hydroxy-5-nitro-6-oxo-

3-Pyridinecarboxamide, 1,6-dihydro-4-hydroxy-5-nitro-6-oxo-

CAS: 89247-06-3

Formula: C₆H₅N₃O₅

Molecular weight: 199.121

Ref: IN-DA004263