CAS 89250-26-0
:2-(Chloromethyl)-4-(4-nitrophenyl)thiazole
Description:
2-(Chloromethyl)-4-(4-nitrophenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a chloromethyl group, which enhances its reactivity, and a nitrophenyl group that contributes to its electronic properties and potential applications in various chemical reactions. The presence of the nitro group typically increases the compound's polarity and can influence its solubility in different solvents. This substance is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. Additionally, the thiazole moiety is known for its biological activity, making compounds like this of interest in medicinal chemistry. Safety data should be consulted, as the chloromethyl and nitro groups can pose hazards, including toxicity and environmental concerns. Proper handling and disposal procedures are essential when working with this compound in a laboratory setting.
Formula:C10H7ClN2O2S
InChI:InChI=1S/C10H7ClN2O2S/c11-5-10-12-9(6-16-10)7-1-3-8(4-2-7)13(14)15/h1-4,6H,5H2
InChI key:InChIKey=LEBRGKZHLICZCZ-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(=CS1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 2-(Chloromethyl)-4-(4-nitrophenyl)thiazole
- Astragalus pulysacharide
- Thiazole, 2-(Chloromethyl)-4-(4-Nitrophenyl)-
- Thiazole, 2-(chloromethyl)-4-(p-nitrophenyl)-
- 2-(Chloromethyl)-4-(4-nitrophenyl)-1,3-thiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Astragalus polysaccharide
CAS:Formula:C10H7ClN2O2SPurity:65%Color and Shape:SolidMolecular weight:254.6928Astragalus polysaccharide
CAS:Astragalus polysaccharide, a natural product derived from Astragalus propinquusFormula:C10H7ClN2O2SPurity:70% - 98%Color and Shape:SolidMolecular weight:254.692-(Chloromethyl)-4-(4-nitrophenyl)-1,3-thiazole
CAS:2-(Chloromethyl)-4-(4-nitrophenyl)-1,3-thiazolePurity:70%Molecular weight:254.69g/molAstragalus polysaccharide
CAS:The chemical structure of Astragalus polysaccharide is complex and consists of an α-D-(1,4)-Glc and (1,6)-α-D-Glcp backbone, and a branch point at O-6. The molecular weight is approximately 3.01 × 105 Da from Mongolian Astragalus using low concentration of ethanol for precipitation and gel chromatography for purification. Spectral analysis results of 1H NMR and 13C NMR showed that the polysaccharide backbone has a 1,3-linked β-D-Gal residue and the branched portion has β-Glc, 1,6-linked α-Gal; 1,5-linked β-Xyl; 1,4-linked β-Gal; β-D-Gal, 1,2-linked α-Rha; and 1,2,4-linked α-Rha residues.
Formula:C10H7ClN2O2SPurity:Min. 95%Color and Shape:Brown PowderMolecular weight:254.69 g/mol



