CAS 892501-89-2

N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine

Description:

N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine, with the CAS number 892501-89-2, is a chemical compound characterized by its unique structure that includes a thiazole ring and an amine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which can influence its reactivity and interactions. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The N-methyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the compound may exhibit basic properties due to the amine functional group, allowing it to participate in protonation reactions. Its molecular structure may also confer specific binding affinities to biological targets, making it of interest in medicinal chemistry. Overall, N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine represents a class of compounds that could be explored for various applications, particularly in drug development and synthesis.

Formula: C₁₁H₁₂N₂S

InChI: InChI=1/C11H12N2S/c1-12-8-9-3-2-4-10(7-9)11-13-5-6-14-11/h2-7,12H,8H2,1H3

SMILES: CNCc1cccc(c1)c1nccs1

Synonyms:

• N-methyl-3-(1,3-thiazol-2-yl)benzylamine

methyl({[3-(1,3-thiazol-2-yl)phenyl]methyl})amine

CAS: 892501-89-2

Formula: C₁₁H₁₂N₂S

Molecular weight: 204.2914

Ref: IN-DA00425L