CymitQuimica logo

CAS 892501-89-2

:

N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine

Description:
N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine, with the CAS number 892501-89-2, is a chemical compound characterized by its unique structure that includes a thiazole ring and an amine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which can influence its reactivity and interactions. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The N-methyl group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the compound may exhibit basic properties due to the amine functional group, allowing it to participate in protonation reactions. Its molecular structure may also confer specific binding affinities to biological targets, making it of interest in medicinal chemistry. Overall, N-methyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine represents a class of compounds that could be explored for various applications, particularly in drug development and synthesis.
Formula:C11H12N2S
InChI:InChI=1/C11H12N2S/c1-12-8-9-3-2-4-10(7-9)11-13-5-6-14-11/h2-7,12H,8H2,1H3
SMILES:CNCc1cccc(c1)c1nccs1
Synonyms:
  • N-methyl-3-(1,3-thiazol-2-yl)benzylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.