CAS 892501-90-5
:N-Methyl-4-(2-pyridinyloxy)benzenemethanamine
Description:
N-Methyl-4-(2-pyridinyloxy)benzenemethanamine, identified by its CAS number 892501-90-5, is a chemical compound characterized by its unique molecular structure, which includes a methyl group, a benzene ring, and a pyridine moiety. This compound typically exhibits properties associated with both amines and aromatic compounds, such as moderate solubility in polar solvents and potential basicity due to the presence of the amine functional group. The pyridinyloxy group can contribute to its reactivity and interaction with biological systems, making it of interest in medicinal chemistry and pharmacology. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic components. Additionally, the compound's specific functional groups suggest potential applications in drug development, particularly in targeting specific receptors or enzymes. Overall, N-Methyl-4-(2-pyridinyloxy)benzenemethanamine represents a versatile structure with implications in various chemical and biological contexts.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c1-14-10-11-5-7-12(8-6-11)16-13-4-2-3-9-15-13/h2-9,14H,10H2,1H3
InChI key:InChIKey=AFHNQZMRTDPSDR-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CNC)C=C1)C2=CC=CC=N2
Synonyms:- Benzenemethanamine, N-methyl-4-(2-pyridinyloxy)-
- N-Methyl-4-(2-pyridinyloxy)benzenemethanamine
- N-methyl-N-[4-(pyridin-2-yloxy)benzyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.