
CAS 892501-97-2
:5-(4-Methyl-1-piperazinyl)-2-pyridinecarboxaldehyde
Description:
5-(4-Methyl-1-piperazinyl)-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine and piperazine moieties. It features a pyridine ring substituted with an aldehyde group and a piperazine ring that includes a methyl group at the 4-position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperazine ring often contributes to the compound's ability to interact with biological targets, such as receptors or enzymes. Additionally, the aldehyde functional group can participate in various chemical reactions, including condensation and reduction, which may be useful in synthetic applications. Safety and handling considerations should be taken into account, as with many organic compounds, due to potential toxicity or reactivity. Overall, 5-(4-Methyl-1-piperazinyl)-2-pyridinecarboxaldehyde represents a versatile building block in organic synthesis and drug development.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-13-4-6-14(7-5-13)11-3-2-10(9-15)12-8-11/h2-3,8-9H,4-7H2,1H3
InChI key:InChIKey=VMELMHKVXYUASS-UHFFFAOYSA-N
SMILES:C(=O)C=1C=CC(=CN1)N2CCN(C)CC2
Synonyms:- 2-Pyridinecarboxaldehyde, 5-(4-methyl-1-piperazinyl)-
- 5-(4-Methyl-1-piperazinyl)-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.