CAS 892502-04-4

1-[5-(2-furyl)-2-pyridyl]-N-methyl-methanamine

Description:

1-[5-(2-furyl)-2-pyridyl]-N-methyl-methanamine, with the CAS number 892502-04-4, is a chemical compound characterized by its unique structure that includes a furan ring and a pyridine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the furan and pyridine rings contributes to its potential for aromatic interactions and may influence its solubility in various solvents. It may also display biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in various chemical reactions, including alkylation and acylation, due to the reactive amine group. Additionally, its specific stereochemistry and substituents can affect its reactivity and interactions with biological targets. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and medicinal chemistry applications.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1/C11H12N2O/c1-12-8-10-5-4-9(7-13-10)11-3-2-6-14-11/h2-7,12H,8H2,1H3

SMILES: CNCc1ccc(cn1)c1ccco1

2-Pyridinemethanamine,5-(2-furanyl)-N-methyl-

CAS: 892502-04-4

Formula: C₁₁H₁₂N₂O

Molecular weight: 188.2258

Ref: IN-DA00425I

5-(Fur-2-yl)-2-[methyl(aminomethyl)]pyridine

CAS: 892502-04-4

5-(Fur-2-yl)-2-[methyl(aminomethyl)]pyridine

Purity: 95%

Color and Shape: Liquid

Molecular weight: 188.23g/mol

Ref: 54-OR59896