CAS 892502-08-8
:N-Methyl-4-(1H-pyrazol-1-ylmethyl)benzenemethanamine
Description:
N-Methyl-4-(1H-pyrazol-1-ylmethyl)benzenemethanamine, with the CAS number 892502-08-8, is an organic compound characterized by its complex structure that includes a benzene ring, a pyrazole moiety, and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the pyrazole ring may impart unique biological activities, making it of interest in pharmaceutical research. Additionally, the methyl group attached to the nitrogen atom can affect the compound's steric and electronic properties, potentially enhancing its reactivity or selectivity in chemical reactions. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-Methyl-4-(1H-pyrazol-1-ylmethyl)benzenemethanamine represents a class of compounds that may have applications in medicinal chemistry and material science.
Formula:C12H15N3
InChI:InChI=1S/C12H15N3/c1-13-9-11-3-5-12(6-4-11)10-15-8-2-7-14-15/h2-8,13H,9-10H2,1H3
InChI key:InChIKey=BQLXMVISWVMAID-UHFFFAOYSA-N
SMILES:C(C1=CC=C(CNC)C=C1)N2C=CC=N2
Synonyms:- Benzenemethanamine, N-methyl-4-(1H-pyrazol-1-ylmethyl)-
- N-Methyl-4-(1H-pyrazol-1-ylmethyl)benzenemethanamine
- N-methyl-4-(1H-pyrazol-1-ylmethyl)benzylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
