CymitQuimica logo

CAS 892502-10-2

:

N-methyl-1-[3-(1H-pyrazol-1-ylmethyl)phenyl]methanamine

Description:
N-methyl-1-[3-(1H-pyrazol-1-ylmethyl)phenyl]methanamine, identified by its CAS number 892502-10-2, is an organic compound characterized by its complex structure, which includes a pyrazole moiety and an amine group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyrazole ring may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, N-methyl-1-[3-(1H-pyrazol-1-ylmethyl)phenyl]methanamine represents a class of compounds that may have significant implications in drug development and pharmacology.
Formula:C12H15N3
InChI:InChI=1/C12H15N3/c1-13-9-11-4-2-5-12(8-11)10-15-7-3-6-14-15/h2-8,13H,9-10H2,1H3
SMILES:CNCc1cccc(c1)Cn1cccn1
Synonyms:
  • N-methyl-3-(1H-pyrazol-1-ylmethyl)benzylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.