CymitQuimica logo

CAS 892502-15-7

:

4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]morpholine

Description:
4-[2-(Chloromethyl)-4-(trifluoromethyl)phenyl]morpholine, with the CAS number 892502-15-7, is a chemical compound characterized by its unique molecular structure, which includes a morpholine ring and a phenyl group substituted with both chloromethyl and trifluoromethyl groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The trifluoromethyl group is known for imparting lipophilicity and enhancing the compound's biological activity. Morpholine derivatives often exhibit interesting pharmacological properties, making this compound of interest in medicinal chemistry. Additionally, the presence of halogen atoms can influence the compound's stability and interaction with biological targets. Overall, 4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]morpholine is a compound with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its distinctive chemical characteristics.
Formula:C12H13ClF3NO
InChI:InChI=1/C12H13ClF3NO/c13-8-9-7-10(12(14,15)16)1-2-11(9)17-3-5-18-6-4-17/h1-2,7H,3-6,8H2
InChI key:InChIKey=KCGVSWOLBMMCMW-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(C=CC(C(F)(F)F)=C1)N2CCOCC2
Synonyms:
  • Morpholine, 4-[2-(chloromethyl)-4-(trifluoromethyl)phenyl]-
  • 4-[2-(Chloromethyl)-4-(trifluoromethyl)phenyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.