CymitQuimica logo

CAS 892502-16-8

:

2-Bromo-6-[(tetrahydro-2H-pyran-4-yl)oxy]pyridine

Description:
2-Bromo-6-[(tetrahydro-2H-pyran-4-yl)oxy]pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions. The presence of a bromine atom at the 2-position introduces a halogen functionality, enhancing its reactivity and potential for further chemical modifications. The 6-position features a tetrahydro-2H-pyran-4-yl ether group, which contributes to the compound's overall hydrophobicity and may influence its solubility and biological activity. This compound is likely to exhibit polar characteristics due to the ether linkage, while the bromine atom can impart electrophilic properties. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the pyridine moiety is often associated with various biological activities. Additionally, the compound's unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug discovery and development.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c11-9-2-1-3-10(12-9)14-8-4-6-13-7-5-8/h1-3,8H,4-7H2
InChI key:InChIKey=VLEKIKTZHYMZEW-UHFFFAOYSA-N
SMILES:O(C=1N=C(Br)C=CC1)C2CCOCC2
Synonyms:
  • 2-Bromo-6-(oxan-4-yloxy)pyridine
  • 2-Bromo-6-(tetrahydropyran-4-yloxy)pyridine
  • 2-Bromo-6-[(tetrahydro-2H-pyran-4-yl)oxy]pyridine
  • Pyridine, 2-bromo-6-[(tetrahydro-2H-pyran-4-yl)oxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.