CAS 892502-17-9

N-Methyl-2-(phenoxymethyl)benzenemethanamine

Description:

N-Methyl-2-(phenoxymethyl)benzenemethanamine, identified by its CAS number 892502-17-9, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both a phenoxymethyl group and a methylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The phenoxymethyl moiety contributes to its potential for interactions with biological systems, possibly influencing its solubility and reactivity. The presence of the methyl group on the nitrogen atom can enhance lipophilicity, affecting its pharmacokinetic properties. As with many organic compounds, its behavior in various environments, such as solubility in different solvents and stability under various conditions, would be influenced by its molecular structure. Overall, N-Methyl-2-(phenoxymethyl)benzenemethanamine may have applications in medicinal chemistry or as a research chemical, although specific biological activities and applications would require further investigation.

Formula: C₁₅H₁₇NO

InChI: InChI=1S/C15H17NO/c1-16-11-13-7-5-6-8-14(13)12-17-15-9-3-2-4-10-15/h2-10,16H,11-12H2,1H3

InChI key: InChIKey=WFUPXVCKIKJBIM-UHFFFAOYSA-N

SMILES: C(OC1=CC=CC=C1)C2=C(CNC)C=CC=C2

Synonyms:

• Benzenemethanamine, N-methyl-2-(phenoxymethyl)-
• N-Methyl-2-(phenoxymethyl)benzenemethanamine
• N-methyl-2-(phenoxymethyl)benzylamine