
CAS 892563-67-6
:N1,N1-Dimethyl-N3-[(2-methylphenyl)methyl]-1,3-propanediamine
Description:
N1,N1-Dimethyl-N3-[(2-methylphenyl)methyl]-1,3-propanediamine is an organic compound characterized by its structure, which includes a propanediamine backbone with two methyl groups attached to one nitrogen atom and a 2-methylphenylmethyl group attached to the other nitrogen. This compound is classified as a diamine due to the presence of two amine functional groups, which can participate in various chemical reactions, including those involving nucleophilic substitution and hydrogen bonding. The presence of the aromatic 2-methylphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents. Additionally, the dimethyl substitution can enhance its steric properties, affecting its reactivity and interaction with biological systems. This compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulations.
Formula:C13H22N2
InChI:InChI=1S/C13H22N2/c1-12-7-4-5-8-13(12)11-14-9-6-10-15(2)3/h4-5,7-8,14H,6,9-11H2,1-3H3
InChI key:InChIKey=VKJMYNDNJWPZBX-UHFFFAOYSA-N
SMILES:C(NCCCN(C)C)C1=C(C)C=CC=C1
Synonyms:- [3-(Dimethylamino)propyl][(2-methylphenyl)methyl]amine
- N1,N1-Dimethyl-N3-[(2-methylphenyl)methyl]-1,3-propanediamine
- 1,3-Propanediamine, N1,N1-dimethyl-N3-[(2-methylphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.