CAS 892565-10-5

N,N-dimethyl-N'-(2-methylbenzyl)ethane-1,2-diamine

Description:

N,N-Dimethyl-N'-(2-methylbenzyl)ethane-1,2-diamine is an organic compound characterized by its amine functional groups and a complex structure that includes a dimethylamino group and a 2-methylbenzyl substituent. This compound features two amine groups, which can participate in hydrogen bonding, influencing its solubility and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the aromatic 2-methylbenzyl group contributes to its hydrophobic characteristics, while the dimethylamino groups enhance its basicity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its CAS number, 892565-10-5, allows for easy identification in chemical databases. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, N,N-dimethyl-N'-(2-methylbenzyl)ethane-1,2-diamine is a versatile compound with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₂H₂₀N₂

InChI: InChI=1/C12H20N2/c1-11-6-4-5-7-12(11)10-13-8-9-14(2)3/h4-7,13H,8-10H2,1-3H3

SMILES: Cc1ccccc1CNCCN(C)C

Synonyms:

• 1,2-ethanediamine, N~1~,N~1~-dimethyl-N~2~-[(2-methylphenyl)methyl]-