CymitQuimica logo

CAS 892571-13-0

:

N-(4-ethoxybenzyl)cyclopropanamine

Description:
N-(4-ethoxybenzyl)cyclopropanamine is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of the ethoxybenzyl group indicates that the compound has an ethoxy group (–O–CH2–CH3) attached to a benzyl moiety (–C6H4–CH2–) at the nitrogen atom of the amine. This structure contributes to its potential biological activity and solubility properties. The compound may exhibit interesting pharmacological effects due to the combination of the cyclopropane and aromatic systems, which can influence its interaction with biological targets. Additionally, the ethoxy group can enhance lipophilicity, potentially affecting its absorption and distribution in biological systems. As with many amines, N-(4-ethoxybenzyl)cyclopropanamine may also participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-2-14-12-7-3-10(4-8-12)9-13-11-5-6-11/h3-4,7-8,11,13H,2,5-6,9H2,1H3
SMILES:CCOc1ccc(cc1)CNC1CC1
Synonyms:
  • benzenemethanamine, N-cyclopropyl-4-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.