CAS 892571-43-6

N-[(3-methylthiophen-2-yl)methyl]cyclopropanamine

Description:

N-[(3-methylthiophen-2-yl)methyl]cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropanamine moiety and a 3-methylthiophen-2-yl group. This compound features a cyclopropane ring, which contributes to its rigidity and can influence its reactivity and interaction with biological targets. The presence of the thiophene ring, a five-membered aromatic heterocycle containing sulfur, adds to its electronic properties and potential for engaging in π-π stacking interactions. The methyl group on the thiophene enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific interactions and effects would depend on the context of its use, including the biological systems it interacts with. As with many organic compounds, its stability, reactivity, and potential applications would be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₉H₁₃NS

InChI: InChI=1/C9H13NS/c1-7-4-5-11-9(7)6-10-8-2-3-8/h4-5,8,10H,2-3,6H2,1H3

SMILES: Cc1ccsc1CNC1CC1

Synonyms:

• 2-thiophenemethanamine, N-cyclopropyl-3-methyl-
• N-[(3-Methyl-2-thienyl)methyl]cyclopropanamine
• N-[(3-methylthien-2-yl)methyl]cyclopropanamine

N-[(3-METHYL-2-THIENYL)METHYL]CYCLOPROPANAMINE

CAS: 892571-43-6

Formula: C₉H₁₃NS

Molecular weight: 167.2712

Ref: IN-DA0042ZU