CAS 892571-49-2
:2-methoxy-N-[(3-methylthiophen-2-yl)methyl]ethanamine
Description:
2-Methoxy-N-[(3-methylthiophen-2-yl)methyl]ethanamine, with the CAS number 892571-49-2, is a chemical compound characterized by its unique molecular structure, which includes a methoxy group and a thiophene derivative. This compound features an ethanamine backbone, which contributes to its potential as a biological or pharmacological agent. The presence of the methoxy group enhances its solubility and may influence its reactivity and interaction with biological targets. The 3-methylthiophen-2-yl moiety introduces aromatic characteristics, which can affect the compound's electronic properties and stability. Such compounds often exhibit interesting pharmacological activities, making them subjects of research in medicinal chemistry. Additionally, the presence of sulfur in the thiophene ring can impart unique properties, such as increased lipophilicity or specific interactions with biological systems. Overall, 2-methoxy-N-[(3-methylthiophen-2-yl)methyl]ethanamine is a compound of interest due to its structural features and potential applications in various fields, including drug development and organic synthesis.
Formula:C9H15NOS
InChI:InChI=1/C9H15NOS/c1-8-3-6-12-9(8)7-10-4-5-11-2/h3,6,10H,4-5,7H2,1-2H3
SMILES:Cc1ccsc1CNCCOC
Synonyms:- 2-Methoxy-N-[(3-methyl-2-thienyl)methyl]ethanamine
- 2-thiophenemethanamine, N-(2-methoxyethyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
