CAS 892576-76-0

N-(4-ethylbenzyl)cyclopropanamine

Description:

N-(4-ethylbenzyl)cyclopropanamine is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of the 4-ethylbenzyl substituent indicates that the compound has a benzene ring with an ethyl group attached to the para position, contributing to its hydrophobic characteristics. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. Additionally, the cyclopropane moiety can impart unique steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. The compound's structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the potential for specific interactions with biological targets. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its applications and safety profile.

Formula: C₁₂H₁₇N

InChI: InChI=1/C12H17N/c1-2-10-3-5-11(6-4-10)9-13-12-7-8-12/h3-6,12-13H,2,7-9H2,1H3

SMILES: CCc1ccc(cc1)CNC1CC1

Synonyms:

• benzenemethanamine, N-cyclopropyl-4-ethyl-

N-[(4-ethylphenyl)methyl]cyclopropanamine

CAS: 892576-76-0

Formula: C₁₂H₁₇N

Molecular weight: 175.2701

Ref: IN-DA0042ZO