CAS 892578-19-7
:N-(3-ethoxybenzyl)cyclopropanamine
Description:
N-(3-ethoxybenzyl)cyclopropanamine is an organic compound characterized by its unique structure, which includes a cyclopropane ring and an ethoxybenzyl group. This compound features a cyclopropanamine moiety, indicating the presence of a three-membered carbon ring (cyclopropane) attached to an amine functional group. The ethoxybenzyl substituent contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The presence of the ethoxy group may enhance the compound's lipophilicity, making it more soluble in organic solvents compared to water. Additionally, the benzyl group can provide steric hindrance, which may affect the compound's interaction with biological targets. N-(3-ethoxybenzyl)cyclopropanamine may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific applications and biological activity would depend on the context of its use and the interactions it has with various biological systems. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-2-14-12-5-3-4-10(8-12)9-13-11-6-7-11/h3-5,8,11,13H,2,6-7,9H2,1H3
SMILES:CCOc1cccc(c1)CNC1CC1
Synonyms:- benzenemethanamine, N-cyclopropyl-3-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
