CymitQuimica logo

CAS 89258-10-6

:

1-(2-acetyl-10H-phenothiazin-10-yl)-2-[(2E)-2-(4-nitrobenzylidene)hydrazinyl]ethanone

Description:
1-(2-acetyl-10H-phenothiazin-10-yl)-2-[(2E)-2-(4-nitrobenzylidene)hydrazinyl]ethanone, with the CAS number 89258-10-6, is a complex organic compound characterized by its unique structural features. It contains a phenothiazine moiety, which is known for its applications in pharmaceuticals, particularly as antipsychotic agents. The presence of an acetyl group and a hydrazine derivative contributes to its potential reactivity and biological activity. The nitrobenzylidene group suggests that the compound may exhibit significant electronic properties, potentially influencing its interaction with biological targets. This compound may also display various physical properties such as solubility in organic solvents, depending on its functional groups. Its synthesis typically involves multi-step organic reactions, highlighting its complexity. The compound's potential applications could span medicinal chemistry, particularly in the development of new therapeutic agents, but further studies would be necessary to elucidate its specific biological activities and mechanisms of action. Overall, this compound represents an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C23H18N4O4S
InChI:InChI=1/C23H18N4O4S/c1-15(28)17-8-11-22-20(12-17)26(19-4-2-3-5-21(19)32-22)23(29)14-25-24-13-16-6-9-18(10-7-16)27(30)31/h2-13,25H,14H2,1H3/b24-13+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.