CymitQuimica logo

CAS 892581-28-1

:

2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-2-amine

Description:
2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-2-amine, identified by its CAS number 892581-28-1, is a chemical compound that belongs to the class of substituted amines. This substance features a branched alkyl chain with a methyl group and a thiophene ring, which contributes to its unique properties. The presence of the thiophene moiety can influence the compound's electronic characteristics and potential biological activity. Typically, compounds of this nature may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The molecular structure suggests that it may interact with biological targets, potentially affecting neurotransmitter systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular geometry. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H17NS
InChI:InChI=1/C10H17NS/c1-8-5-6-12-9(8)7-11-10(2,3)4/h5-6,11H,7H2,1-4H3
SMILES:Cc1ccsc1CNC(C)(C)C
Synonyms:
  • 2-Methyl-N-[(3-methyl-2-thienyl)methyl]propan-2-amine
  • 2-thiophenemethanamine, N-(1,1-dimethylethyl)-3-methyl-
  • N-(tert-butyl)-N-[(3-methylthien-2-yl)methyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.