CAS 892588-50-0

N-[4-(1-methylethyl)benzyl]prop-2-en-1-amine

Description:

N-[4-(1-methylethyl)benzyl]prop-2-en-1-amine, with the CAS number 892588-50-0, is an organic compound characterized by its structure, which includes an allylic amine functional group. This compound features a prop-2-en-1-amine backbone, indicating the presence of a double bond between the second and third carbon atoms, along with an amine group (-NH2) that contributes to its reactivity and potential biological activity. The presence of a 4-(1-methylethyl)benzyl substituent suggests that the compound has a bulky aromatic group, which may influence its solubility and interaction with biological targets. Generally, compounds of this nature can exhibit various properties, including potential use in pharmaceuticals or as intermediates in organic synthesis. The specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is studied. Overall, N-[4-(1-methylethyl)benzyl]prop-2-en-1-amine represents a class of compounds that may have significant applications in medicinal chemistry and materials science.

Formula: C₁₃H₁₉N

InChI: InChI=1/C13H19N/c1-4-9-14-10-12-5-7-13(8-6-12)11(2)3/h4-8,11,14H,1,9-10H2,2-3H3

SMILES: C=CCNCc1ccc(cc1)C(C)C

Synonyms:

• benzenemethanamine, 4-(1-methylethyl)-N-2-propen-1-yl-
• N-(4-Isopropylbenzyl)prop-2-en-1-amine

N-(4-ISOPROPYLBENZYL)-2-PROPEN-1-AMINE

CAS: 892588-50-0

Formula: C₁₃H₁₉N

Molecular weight: 189.2967

Ref: IN-DA0041RD

N-(4-isopropylbenzyl)-2-propen-1-amine hydrochloride

CAS: 892588-50-0

Formula: C₁₃H₂₀ClN

Purity: 95.0%

Molecular weight: 225.76

Ref: 10-F361738