CAS 892591-92-3
:2-methyl-2-[(pyridin-2-ylmethyl)amino]propan-1-ol
Description:
2-Methyl-2-[(pyridin-2-ylmethyl)amino]propan-1-ol, with the CAS number 892591-92-3, is a chemical compound characterized by its complex structure, which includes a tertiary alcohol and a pyridine moiety. This compound features a central carbon atom bonded to a hydroxyl group (-OH), a methyl group, and a pyridin-2-ylmethylamino group, contributing to its unique properties. The presence of the pyridine ring suggests potential for interactions such as hydrogen bonding and coordination with metal ions, which may enhance its biological activity. The compound is likely to be soluble in polar solvents due to the hydroxyl group, while the hydrophobic methyl and pyridine groups may influence its lipophilicity. Its structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. Additionally, the presence of both basic and acidic functional groups may allow for diverse reactivity and interaction with various biological targets.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c1-10(2,8-13)12-7-9-5-3-4-6-11-9/h3-6,12-13H,7-8H2,1-2H3
SMILES:CC(C)(CO)NCc1ccccn1
Synonyms:- 1-Propanol, 2-Methyl-2-[(2-Pyridinylmethyl)Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
